| Poly(3-butylthiophene-2,5-diyl) (P3BT) is an alkylthiophene based conducting polymer that can be used as a donor molecule in the development of organic electronics. It is a p-conjugating polymer with a p-p stacking distance of 0.395 nm. Applications: P3BT can act as a hole transporting layer (HTL) which can potentially be used in the fabrication of organic field effect transistors (OFETs), chemical sensors, rechargeable batteries and polymeric solar cells (PSCs). Molecular Formula: C10H16S IUPAC Name: 3-butyl-2,5-dimethylthiophene Synonyms: P3BT SMILES: CCCCC1=C(SC(=C1)C)C InChI=1S/C10H16S/c1-4-5-6-10-7-8(2)11-9(10)3/h7H,4-6H2,1-3H3; InChiKey = DUOSBQJOYVIVOR-UHFFFAOYSA-N Alfa Chemistry Materials product group: Polymer/Macromolecule Manufacturer data sheet |