Molecular Formula: C16H26O6 IUPAC Name: butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid Synonyms: acrylic acid; butyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate, 26898-31-7, 438552-03-5, AC1Q66TA, AC1L528C, CTK4I7815, Methyl methacrylate, butyl methacrylate, acrylic acid resin, AR-1H6541, AG-J-79319, Acrylic acid, methyl methacrylate, butyl methacrylate polymer, butyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate; prop-2-enoic acid, 2-Propenoic acid, 2-methyl-, butyl ester, polymer with methyl 2-methyl-2-propenoate and 2-propenoic acid SMILES: CCCCOC(=O)C(=C)C.CC(=C)C(=O)OC.C=CC(=O)O InChiKey = NDXQAHKCTLWEKI-UHFFFAOYSA-N Manufacturer data sheet |