Applications: 1,10-Phenanthrolin-5-amine is a potential fluorescent label for DNA detection. 1,10-Phenanthrolin-5-amine is used as a mediator for glucose oxidase for development of biosensors and biofuel cells Molecular Formula: C12H9N3 IUPAC Name: 1,10-phenanthrolin-5-amine Synonyms: V2353; DB-050451; QC-4684; M-2320; (1,10)-Phenanthrolin-5-ylamine; ZB009397; AB0021123; ST24036612; AX8043363; FT-0673671; SMILES: C1=CC2=CC(=C3C=CC=NC3=C2N=C1)N; InChI=1S/C12H9N3/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H,13H2;; InChiKey = DKPSSMOJHLISJI-UHFFFAOYSA-N; Alfa Chemistry Materials product group: Semiconductor Manufacturer data sheet |